ChemNet > CAS > 219719-19-4 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine
219719-19-4 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine
| 상품명칭 |
5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine |
| 영문 이름 |
5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine;5-[(2-methylquinolin-4-yl)sulfanyl]-1,3,4-thiadiazol-2-amine |
| 분자식 |
C12H10N4S2 |
| 분자량 |
274.3646 |
| InChI |
InChI=1/C12H10N4S2/c1-7-6-10(17-12-16-15-11(13)18-12)8-4-2-3-5-9(8)14-7/h2-6H,1H3,(H2,13,15) |
| cas번호 |
219719-19-4 |
| 분자 구조 |
![219719-19-4 5-[(2-methyl-4-quinolyl)thio]-1,3,4-thiadiazol-2-amine](https://images-a.chemnet.com/suppliers/chembase/299/29949.gif)
|
| 밀도 |
1.47g/cm3 |
| 녹는 점 |
205℃ |
| 비등점 |
512.8°C at 760 mmHg |
| 굴절 지수 |
1.762 |
| 인화점 |
263.9°C |
| 증기압 |
1.25E-10mmHg at 25°C |
| 위험성 표시 |
 Xn:Harmful;
|
| 리스크 규칙 |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| 보안 규칙 |
S36/37:Wear suitable protective clothing and gloves.;
|
|
